Source: Wikipedia, the free encyclopedia.
Chemical compound
Cyanodothiepin |
|
Other names | BTS-56424 |
---|
ATC code | |
---|
|
|
JSmol) | |
---|
|
InChI=1S/C20H20N2S/c1-22(2)11-5-8-18-17-7-4-3-6-16(17)14-23-20-10-9-15(13-21)12-19(18)20/h3-4,6-10,12H,5,11,14H2,1-2H3/b18-8+ Key:FSIRGTNPQFDCCD-QGMBQPNBSA-N
|
Cyanodothiepin (developmental code name BTS-56424) is a
monoamine depletion-based tests of antidepressant potential.
[1]
See also
References
- ^ .
- ^ . Retrieved 2011-11-25.
- ^ . Retrieved 2011-11-25.
- Tooltip Selective serotonin reuptake inhibitors
| |
---|
Tooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
Tooltip Norepinephrine reuptake inhibitors | |
---|
Tooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
Tooltip Noradrenergic and specific serotonergic antidepressants | |
---|
Tooltip Serotonin antagonist and reuptake inhibitors | |
---|
Tooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
Tooltip Tricyclic antidepressants | |
---|
Tooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|