Source: Wikipedia, the free encyclopedia.
Chemical compound
Eclanamine |
|
ATC code | |
---|
|
|
JSmol) | |
---|
|
InChI=1S/C16H22Cl2N2O/c1-4-16(21)20(11-8-9-12(17)13(18)10-11)15-7-5-6-14(15)19(2)3/h8-10,14-15H,4-7H2,1-3H3/t14-,15-/m1/s1 Key:YCRFSKUCDBJWLX-HUUCEWRRSA-N
|
Eclanamine (U-48,753) is a drug which was patented as an antidepressant, but was never marketed.[1] It acts by inhibiting the reuptake of serotonin and norepinephrine.[2]
See also
References
- Tooltip Selective serotonin reuptake inhibitors
| |
---|
Tooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
Tooltip Norepinephrine reuptake inhibitors | |
---|
Tooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
Tooltip Noradrenergic and specific serotonergic antidepressants | |
---|
Tooltip Serotonin antagonist and reuptake inhibitors | |
---|
Tooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
Tooltip Tricyclic antidepressants | |
---|
Tooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|
- Tooltip Dopamine reuptake inhibitors)
| |
---|
Tooltip Norepinephrine reuptake inhibitors) | | | | | | |
- Others: )
- Antipsychotics (e.g., loxapine, ziprasidone)
- Arylcyclohexylamines (e.g., ketamine, phencyclidine)
- Dopexamine
- Ephenidine
- Ginkgo biloba
- Indeloxazine
- Nefazodone
- Opioids (e.g., desmetramadol, methadone, pethidine (meperidine), tapentadol, tramadol, levorphanol)
|
|
---|
Tooltip Serotonin reuptake inhibitors) | | | | |
- Others: A-80426
- Amoxapine
- Antihistamines (e.g., brompheniramine, chlorphenamine, dimenhydrinate, diphenhydramine, mepyramine (pyrilamine), pheniramine, tripelennamine)
- Antipsychotics (e.g., loxapine, ziprasidone)
- Arylcyclohexylamines (e.g., 3-MeO-PCP, esketamine, ketamine, methoxetamine, phencyclidine)
- Cyclobenzaprine
- Delucemine
- Dextromethorphan
- Dextrorphan
- Efavirenz
- Hypidone
- Medifoxamine
- Mesembrine
- Mifepristone
- MIN-117 (WF-516)
- N-Me-5-HT
- Opioids (e.g., dextropropoxyphene, methadone, pethidine (meperidine), levorphanol, tapentadol, tramadol)
- Roxindole
|
|
---|
Tooltip Vesicular monoamine transporters | |
---|
Others | |
---|
|