Source: Wikipedia, the free encyclopedia.
Chemical compound
Troxerutin |
|
Other names | Hydroxyethylrutoside (HER) Pherarutin Trihydroxyethylrutin 3',4',7-Tris[O-(2-hydroxyethyl)]rutin |
---|
AHFS/Drugs.com | International Drug Names |
---|
ATC code | |
---|
|
|
JSmol) | |
---|
|
InChI=1S/C33H42O19/c1-14-23(38)26(41)28(43)32(49-14)48-13-21-24(39)27(42)29(44)33(51-21)52-31-25(40)22-17(37)11-16(45-7-4-34)12-20(22)50-30(31)15-2-3-18(46-8-5-35)19(10-15)47-9-6-36/h2-3,10-12,14,21,23-24,26-29,32-39,41-44H,4-9,13H2,1H3/t14-,21+,23-,24+,26+,27-,28+,29+,32+,33-/m0/s1 NKey:IYVFNTXFRYQLRP-VVSTWUKXSA-N N
|
NY (what is this?) (verify) |
Troxerutin is a
Sophora japonica
, the Japanese pagoda tree.
It is used as a vasoprotective.[2]
Troxerutin has been shown in mice to reverse CNS insulin resistance and reduce reactive oxygen species induced by a high-cholesterol diet.[3]
References
Flavonols and their conjugates |
---|
Backbone | |
---|
Flavonols | |
---|
O-Methylated flavonols | |
---|
Derivative flavonols | |
---|
Pyranoflavonols | |
---|
Furanoflavonols | |
---|
Semisynthetic | |
---|