Fluoride phosphate
The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.
Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.
They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.
Minerals
name | formula | ratio
PO4:F |
formula weight | crystal system | space group | unit cell | volume | density | refractive index | comment | reference |
---|---|---|---|---|---|---|---|---|---|---|---|
Althausite | Mg4(PO4)2(OH,O)(F,☐) | 2:~1 | Orthorhombic | Pnma | a = 8.258 b = 6.054, c = 14.383 | 719.06 | 2.97 | Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598
2V: measured: 70° , calculated: 80° Max birefringence: δ = 0.010 |
[1] | ||
Amblygonite | LiAl(PO4)F | 1:1 | Triclinic | P1 | a = 6.644 b = 7.744 c = 6.91
α = 90.35°, β = 117.33°, γ = 91.01° Z=4 |
315.75 | 3.04-3.11 | Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613
2V: Measured: 107° to 129.5° Birefringence: 0.020 |
[2] | ||
aravaite | Ba2Ca18(SiO4)6(PO4)3(CO3)F3O | 3:3 | trigonal | R3m | a = 7.1255, c = 66.290 Z=3 | 2914.8 | [3] | ||||
Arctite | Na2Ca4(PO4)3F | 3:1 | Trigonal | R3m | a = 7.078 c = 41.203 Z=6 | 1,787.64 | 3.13 | Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001 | [4] | ||
Ariegilatite | BaCa12(SiO4)4(PO4)2F2O | Trigonal | R3m | a = 7.1551 c = 41.303 | 1381.2 | Uniaxial (-) nω = 1.650 nε = 1.647
Max Birefringence: δ = 0.003 |
[5] | ||||
Babefphite | BaBePO4(F,OH) | 1:~1 | Tetragonal | Uniaxial (+) nω = 1.629 nε = 1.632
Max birefringence: δ = 0.003 |
[6] | ||||||
Belovite-(Ce) | NaCeSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.692 c = 7.201 | 585.80 | 4.19 | Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640
Birefringence: 0.015 |
[7] | ||
Belovite-(La) | NaLaSr3(PO4)3F | 3:1 | Trigonal | P3 | a = 9.647 c = 7.17 | 577.88 | 4.19 | Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636
Max birefringence: δ = 0.018 |
[8] | ||
Bøggildite | Na2Sr2Al2PO4F9 | 1:9 | Monoclinic | Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469
2V: 80° Max birefringence:δ = 0.007 |
[9] | ||||||
Carlgieseckeite-(Nd) | NaNdCa3(PO4)3F | Trigonal | P3 | a = 9.4553 c = 6.9825 | 540.62 | 3.91 | [10] | ||||
Cloncurryite | Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O | 2:2 | Monoclinic | P21/b | a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4 | 1145.78 | 2.525 | Biaxial (-) nα = 1.548(2) nγ = 1.550(2)
2V: calculated: 56° Max brefringence: δ = 0.002 |
[11] | ||
Deloneite | (Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5 | Trigonal | P3 | a = 9.51 c = 7.01 Z=2 | 549.05 | 3.92 | Uniaxial (-) nω = 1.682 nε = 1.660
Max birefringence: δ = 0.022 |
[12] | |||
Fluellite | Al2(PO4)F2(OH) · 7H2O | Orthorhombic | Fddd | a = 11.22 b = 21.15 c = 8.54 | 2,027 | 2.139 - 2.17 | Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511
Max birefringence: δ = 0.033 |
[13] | |||
Fluorapatite | Ca5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.3973 c = 6.8782 | 526.03 | 3.1-3.25 | Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646
Birefringence: 0.004 |
[14] | ||
Fluorcaphite | SrCaCa3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.485 c = 7.000 Z=2 | 545.39 | Uniaxial (-) nω = 1.649 nε = 1.637
Max birefringence: δ = 0.012 |
[15] | |||
Fluorphosphohedyphane | Ca2Pb3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.640, c = 7.012 Z=2 | 564.4 | 5.445 | Uniaxial (-) nω = 1.836 nε = 1.824
Max birefringence: δ = 0.012 |
[16] | ||
Fluorstrophite | SrCaSr3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.565 c = 7.115 Z=2 | 563.74 | Uniaxial (-) nω = 1.651 nε = 1.637
Max birefringence: δ = 0.014 |
[17] | |||
Francolite | |||||||||||
Herderite | CaBe(PO4)F | Monoclinic | a = 4.81, b = 7.7 c = 9.82 β = 90.1° | 363.7 | 3.02 | Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620
2V: calculated: 70° Max birefringence: δ = 0.033 |
[18] | ||||
Iangreyite | Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O | 4:~15 | Trigonal | P3 2 1 | a = 6.988 c = 16.707 | 706.5 | [19] | ||||
Isokite | CaMg(PO4)F | Monoclinic | B2/b | a = 6.52 b = 8.75 c = 7.51 β = 121.47° | 365.4 | 3.15-3.27 | Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615
2V: ,easured: 51° Max birefringence: δ = 0.025 |
[20] | |||
Kingite | Al3(PO4)2F2(OH) · 7H2O | 2:2 | Triclinic | a = 9.15 b = 10 c = 7.24
α = 98.6°, β = 93.6°, γ = 93.2° |
Biaxial | [21] | |||||
Kuannersuite-(Ce) | NaCeBa3(PO4)3F0.5Cl0.5 | 6:1 | Trigonal | P3 | a = 9.909 c = 7.402 | 629.42 | 4.51 | [22] | |||
Lacroixite | NaAl(PO4)F | 1:1 | Monoclinic | B2/b | a = 6.414 b = 8.207 c = 6.885 β = 115.47° | 327.20 | 3.126 - 3.29 | Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580
2V: measured: 89° Birefringence: 0.034 |
[23] | ||
Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O | 4:1 | Triclinic | a = 10.05 b = 11.56 c = 6.88
α = 105.84°, β = 93.66°, γ = 106.47° |
728.7 | Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534
2V: measured: 55° to 59.7°, calculated: 58° Max birefringence:δ = 0.012 |
[24] | ||||
Minyulite | KAl2(PO4)2(OH,F) · 4H2O | 2:~1 | Orthorhombic | Pba2 | a = 9.34 b = 9.74 c = 5.52 | 502 | 2.47 | Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538
2V: measured: 70° , calculated: 82° Max birefringence: δ = 0.007 |
[25] | ||
Miyahisaite | (Sr,Ca)2Ba3(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.921, c = 7.469 Z=2 | 636.7 | 4.511 | [26] | |||
Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O | 2:4 | Monoclinic | 2.94 | Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565
2V: measured: 43° , calculated: 44° Max birefringence: δ = 0.014 |
[27] | |||||
Nacaphite | Na2Ca(PO4)F | Monoclinic | P21/b | a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8 | 922.81 | Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520
2V: 80° Max birefringence: δ = 0.012 |
[28] | ||||
natrophosphate | Na7(PO4)2F.19H2O | 2:1 | Isometric | Fd3c | a = 27.79 Z=56 | 21,461.78 | 1,71-1.72 | Isotropic | [29][30] | ||
Nefedovite | Na5Ca4(PO4)4F | 4:1 | Triclinic | a = 5.4 Å, b = 11.64 Å, c = 16.48 Å
α = 134.99°, β = 90.04°, γ = 89.96° |
732.60 | Biaxial (+) nα = 1.571 nγ = 1.590
Max birefringence: δ = 0.019 |
[31] | ||||
Nevadaite | (Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O | 8:8 | Orthorhombic | P21mn | a = 12.123 b = 18.999 c = 4.961 | 2.54 | Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553
2V: measured: 76°, calculated: 76° Max birefringence: δ = 0.013 |
[32] | |||
Panasqueiraite | CaMg(PO4)(OH,F) | 1:~1 | monoclinic | a = 6.53 b = 8.75 c = 6.91 β = 112.33° | 365.2 | 3.27 | Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616
2V: measured: 51° , calculated: 58° Max birefringence: δ = 0.026 |
[33] | |||
Richellite | CaFe3+2(PO4)2(OH,F)2 | 2:~2 | a = 5.18 c = 12.61 | [34] | |||||||
Stronadelphite | Sr5(PO4)3F | 3:1 | Hexagonal | P63/m | a = 9.845 c = 7.383 | 619.72 | Uniaxial (-) nω = 1.630(1) nε = 1.623(1)
Max birefringence: δ = 0.007 |
[35] | |||
Triplite | Mn2+2(PO4)F | 1:1 | Monoclinic | P21/b | a = 11.9 b = 6.52 c = 10.09 β = 105.62° | 758.4 | 3.9 | Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680
2V: measured: 70° to 90°, calculated: 72° Max birefringence: δ = 0.030 |
[36] | ||
Väyrynenite | Mn2+Be(PO4)(OH,F) | 1:~1 | Monoclinic | P21/b | a = 5.411 b = 14.49 c = 4.73 β = 102.75° | 361.71 | 3.22 | Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667
2V: measured: 46° to 55°, Ccalculated: 51° to 57° Max birefringence: δ = 0.026 - 0.027 |
[37] | ||
Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 | 1:~3 | Monoclinic | a = 6.83 b = 7.14 c = 5.44 β = 109.37° | 250.27 | Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571
2V: measured: 81° , calculated: 80° Max birefringence: δ = 0.014 |
[38] | ||||
Wagnerite | (Mg,Fe2+)2(PO4)F | 1:1 | Monoclinic | P21/b | a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)° | 3454.8 | 3.15 | Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582
2V: Measured: 25° to 35° ? Birefringence:0.046 Max birefringence: δ = 0.015 |
[39] | ||
Wavellite | Al3(PO4)2(OH,F)3 · 5H2O | 2:~3 | Orthorhombic | a = 9.621 b = 17.363 c = 6.994 | 1168.3 | 2.36 | Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561
2V: measured: 60° to 72°, calculated: 60° to 70° Max birefringence: δ = 0.026 |
[40] | |||
Zwieselite | Fe2+2(PO4)F | 1:1 | Monoclinic | P21/b | 753.82 | Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713
2V: measured: 58° , calculated: 60° Max birefringence: δ = 0.017 |
[41] | ||||
Na5-4.5PO4(CO3,F,Cl) | 1:~1 | [29] |
Artificial
name | formula | formula weight | crystal system | space group | unit cell Å | volume | density | refractive index | comment | reference |
---|---|---|---|---|---|---|---|---|---|---|
EMM-9; 4-(dimethylamino)pyridine fluoroaluminophosphate | (DMAP)2Al4P4O17F2•H2O | monoclinic | P21/a | a=14.335 b=13.561 c=14.497 β =101.094° | layered | [42] | ||||
KBPO4F | monoclinic | Cc | [43] | |||||||
Iron-Doped Sodium–Vanadium Fluorophosphate | Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3) | tetrahedral | P42/mnm | a=9.0277 c=10.6259 | 866.0 | [44] | ||||
Na3V2O1.6(PO4)2F1.4 | [44] | |||||||||
Na3V2(PO4)2F3 | [45] | |||||||||
Na2MnPO4F | [46] | |||||||||
α | Na2FePO4F | monoclinic | P21/c | a = 13.675, b = 5.2503, c = 13.7202, β = 120.230° | [46] | |||||
β | Na2FePO4F | orthorhombic | [46] | |||||||
RbBPO4F | 210.25 | cubic | P213 | a=7.5901 Z=4 | 437.26 | 3.194 | colourless | [43] | ||
MIL-145 | RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O | 3187.11 | monoclinic | P2 | a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1 | 2037.30 | 2.598 | colourless | [47] | |
K2SnPO4F3 | 348.86 | monoclinic | P21/c | a=10.039 b=9.415 c=21.602 beta=95.464 Z=12 | 2032.6 | 3.420 | colourless | [48] | ||
K6Sn(P2O7)2F2 | 739.17 | monoclinic | P21/c | a=8.515 b=12.400 c=8.403 beta=99.58 Z=29 | 874.8 | 2.806 | colourless | [48] | ||
K2Sb(P2O7)F | tetragonal | P4bm | a=8.5239 c=5.572 Z=2 | 404.8 | 3.223 | colourless SHG 4.0×KDP | [49] | |||
CsBPO4F | cubic | P213 | a=7.7090 Z=4 | 458.14 | 3.736 | colourless | [43] | |||
Na2PrF2(PO4) | cubic | [50] | ||||||||
Na2NdF2(PO4) | cubic | [50] | ||||||||
Na2SmF2(PO4) | cubic | [50] | ||||||||
Na2EuF2(PO4) | cubic | [50] | ||||||||
Na2TbF2(PO4) | cubic | [50] | ||||||||
Na2PrF2(PO4) | cubic | [50] | ||||||||
PbZn(PO4)F | 386.53 | orthorhombic | Pna21 | a=8.985 b=9.381 c=4.8212 Z=4 | 406.4 | 6.318 | colourless | [51] |
References
- ^ "Althausite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Amblygonite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- S2CID 104301273.
- ^ "Arctite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Ariegilatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Babefphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Belovite-(La): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Bøggildite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Carlgieseckeite-(Nd): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Cloncurryite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Deloneite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorapatite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorcaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorphosphohedyphane: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Fluorstrophite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Herderite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Iangreyite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Isokite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Kingite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Kuannersuite-(Ce): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Lacroixite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Mcauslanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Minyulite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Miyahisaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Morinite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nacaphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ S2CID 140140550.
- ^ "Natrophosphate: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nefedovite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Nevadaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Panasqueiraite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Richellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Stronadelphite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Triplite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Väyrynenite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Viitaniemiite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wagnerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ^ "Wavellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-04.
- ^ "Zwieselite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-03.
- ISSN 0020-1669.
- ^ ISSN 0020-1669.
- ^ S2CID 209384135.
- S2CID 249989441.
- ^ S2CID 226241204.
- PMID 23069866.
- ^ S2CID 203137437.
- S2CID 250308476.
- ^ ISSN 0931-7597.
- S2CID 257419074.