Source: Wikipedia, the free encyclopedia.
Valoneic acid
|
Names
|
Other names
Valoneaic acid
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) YKey: YIWUPYVTWJLBDH-UHFFFAOYSA-N YInChI=1/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) Key: YIWUPYVTWJLBDH-UHFFFAOYAX
|
|
Properties
|
|
C21H14O13; C21H14O15
|
Molar mass
|
474.32 g/mol, 506.32 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Valoneic acid is a hydrolysable tannin. It is a component of some hydrolysable tannins such as mallojaponin.
The difference with its isomer sanguisorbic acid is that the hydroxyl that links the hexahydroxydiphenoyl (HHDP) group to the galloyl group belongs to the HHDP group.
It can be chemically synthesized.[1]
See also
References
External links
|
---|
Moieties | |
---|
Lactones | |
---|
Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
|
---|
Oligomers | |
---|
Other | |
---|