Source: Wikipedia, the free encyclopedia.
Chemical compound used as a cardiac stimulant
Theodrenaline![](//upload.wikimedia.org/wikipedia/commons/thumb/0/08/Theodrenaline.png/220px-Theodrenaline.png) |
|
ATC code | |
---|
|
(RS)-7-(2-{[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino}ethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
|
JSmol) | |
---|
|
InChI=1S/C17H21N5O5/c1-20-15-14(16(26)21(2)17(20)27)22(9-19-15)6-5-18-8-13(25)10-3-4-11(23)12(24)7-10/h3-4,7,9,13,18,23-25H,5-6,8H2,1-2H3 NKey:WMCMJIGLYZDKRN-UHFFFAOYSA-N N
|
N Y (what is this?) (verify) |
Theodrenaline (
It is sometimes combined with cafedrine.[1]
See also
References
Tooltip Concentrative nucleoside transporters | |
---|
Tooltip Equilibrative nucleoside transporters | |
---|
PMATTooltip Plasma membrane monoamine transporter | |
---|
Enzyme (inhibitors) | XOTooltip Xanthine oxidase | |
---|
Others | |
---|
|
---|
Others | |
---|
|